CAS 1193389-28-4: 2-Amino-5-carboxybenzenebutanoic acid
Description:2-Amino-5-carboxybenzenebutanoic acid, also known as a derivative of amino acids, is characterized by its structure, which includes an amino group (-NH2), multiple carboxylic acid groups (-COOH), and a butanoic acid chain. This compound features a benzene ring that is substituted with both an amino group and a carboxylic acid group, contributing to its acidic properties. The presence of these functional groups suggests that it can participate in various chemical reactions, including those typical of amino acids, such as peptide bond formation. Its solubility in water is likely due to the polar nature of the carboxylic acid and amino groups, making it relevant in biological systems. Additionally, the compound may exhibit zwitterionic behavior, where it can exist in a form that has both positive and negative charges, influencing its interactions in biochemical pathways. Overall, 2-Amino-5-carboxybenzenebutanoic acid is significant in the context of biochemical research and potential applications in pharmaceuticals or as a biochemical probe.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c12-9-5-4-8(11(15)16)6-7(9)2-1-3-10(13)14/h4-6H,1-3,12H2,(H,13,14)(H,15,16)
InChI key:InChIKey=QZDRDYKVUQDJIT-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(N)C(=C1)CCCC(=O)O
- Synonyms:
- 2-Amino-5-carboxybenzenebutanoic acid
- Benzenebutanoic acid, 2-amino-5-carboxy-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Amino-3-(3-carboxypropyl)benzoic acid REF: 10-F664474CAS: 1193389-28-4 | 95% | - - - | Discontinued product |
![]() | 4-Amino-3-(3-carboxypropyl)benzoic acid REF: 3D-TXB38928CAS: 1193389-28-4 | Min. 95% | - - - | Discontinued product |

4-Amino-3-(3-carboxypropyl)benzoic acid
Ref: 10-F664474
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

4-Amino-3-(3-carboxypropyl)benzoic acid
Ref: 3D-TXB38928
1g | Discontinued | Request information | |
100mg | Discontinued | Request information |