CAS 1193389-33-1

Benzenemethanamine, N-ethyl-3,4-difluoro-, hydrochloride (1:1)

Description:

Benzenemethanamine, N-ethyl-3,4-difluoro-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine functional group and a substituted benzene ring. The presence of the N-ethyl group indicates that an ethyl group is attached to the nitrogen atom of the amine, while the 3,4-difluoro substitution on the benzene ring introduces two fluorine atoms at the 3 and 4 positions, enhancing its chemical reactivity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. The compound may exhibit properties such as basicity due to the amine group and can participate in various chemical reactions, including nucleophilic substitutions. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and form of the compound. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₁F₂N·ClH

InChI: InChI=1S/C9H11F2N.ClH/c1-2-12-6-7-3-4-8(10)9(11)5-7;/h3-5,12H,2,6H2,1H3;1H

InChI key: InChIKey=DUGSVGFBYSVWDI-UHFFFAOYSA-N

SMILES: C(NCC)C1=CC(F)=C(F)C=C1.Cl

Synonyms:

• Benzenemethanamine, N-ethyl-3,4-difluoro-, hydrochloride (1:1)

[(3,4-Difluorophenyl)methyl](ethyl)amine hydrochloride

CAS: 1193389-33-1

Versatile small molecule scaffold

Formula: C₉H₁₂ClF₂N

Purity: Min. 95%

Molecular weight: 207.65 g/mol

Ref: 3D-TXB38933