
CAS 1193389-35-3
:3-(2-Propyn-1-yloxy)benzenecarbothioamide
Description:
3-(2-Propyn-1-yloxy)benzenecarbothioamide is a chemical compound characterized by its unique functional groups and structural features. It contains a benzene ring substituted with a propynyl ether group and a carbothioamide moiety, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carbothioamide functional group suggests that it may exhibit properties typical of thioureas, such as biological activity or the ability to form coordination complexes. The compound's structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the alkyne functionality in the propynyl group may enable further chemical modifications through reactions like click chemistry. Its solubility and stability can vary depending on the solvent and conditions, which are important considerations for its practical applications. Overall, 3-(2-Propyn-1-yloxy)benzenecarbothioamide represents a versatile scaffold for further exploration in chemical research and development.
Formula:C10H9NOS
InChI:InChI=1S/C10H9NOS/c1-2-6-12-9-5-3-4-8(7-9)10(11)13/h1,3-5,7H,6H2,(H2,11,13)
InChI key:InChIKey=AVJVUIQAJVJJLP-UHFFFAOYSA-N
SMILES:O(CC#C)C1=CC(C(N)=S)=CC=C1
Synonyms:- 3-(2-Propyn-1-yloxy)benzenecarbothioamide
- Benzenecarbothioamide, 3-(2-propyn-1-yloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.