CymitQuimica logo

CAS 1193389-38-6

:

4-(Difluoromethoxy)-3-ethoxybenzeneethanethioamide

Description:
4-(Difluoromethoxy)-3-ethoxybenzeneethanethioamide is a chemical compound characterized by its unique molecular structure, which includes a benzene ring substituted with both difluoromethoxy and ethoxy groups, along with a thioamide functional group. The presence of the difluoromethoxy group suggests that the compound may exhibit interesting electronic properties and potential reactivity due to the electronegative fluorine atoms. The ethoxy group contributes to the compound's hydrophobic character, which may influence its solubility in organic solvents. Thioamides are known for their ability to participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. This compound may have applications in medicinal chemistry or materials science, although specific biological activities or industrial uses would require further investigation. Overall, its unique functional groups and structural features make it a compound of interest for further research in various chemical fields.
Formula:C11H13F2NO2S
InChI:InChI=1S/C11H13F2NO2S/c1-2-15-9-5-7(6-10(14)17)3-4-8(9)16-11(12)13/h3-5,11H,2,6H2,1H3,(H2,14,17)
InChI key:InChIKey=KJNJQXVMUANXPG-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OC(F)F)C=CC(CC(N)=S)=C1
Synonyms:
  • 4-(Difluoromethoxy)-3-ethoxybenzeneethanethioamide
  • Benzeneethanethioamide, 4-(difluoromethoxy)-3-ethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.