CymitQuimica logo

CAS 1193389-41-1

:

3-(Difluoromethoxy)-4-methoxybenzeneethanethioamide

Description:
3-(Difluoromethoxy)-4-methoxybenzeneethanethioamide is a chemical compound characterized by its unique structural features, which include a benzene ring substituted with both difluoromethoxy and methoxy groups, as well as an ethanethioamide functional group. The presence of the difluoromethoxy group introduces significant electronegativity, influencing the compound's reactivity and polarity. The methoxy group contributes to the compound's overall hydrophobic character while also participating in potential hydrogen bonding interactions. The ethanethioamide moiety adds to the compound's functionality, making it relevant in various chemical reactions, particularly in the synthesis of more complex molecules. This compound may exhibit interesting biological activities due to its structural components, which could be explored in medicinal chemistry. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions dictated by its functional groups. Overall, 3-(Difluoromethoxy)-4-methoxybenzeneethanethioamide represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.
Formula:C10H11F2NO2S
InChI:InChI=1S/C10H11F2NO2S/c1-14-7-3-2-6(5-9(13)16)4-8(7)15-10(11)12/h2-4,10H,5H2,1H3,(H2,13,16)
InChI key:InChIKey=PGUCYDZAIDPIRW-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(OC)C=CC(CC(N)=S)=C1
Synonyms:
  • Benzeneethanethioamide, 3-(difluoromethoxy)-4-methoxy-
  • 3-(Difluoromethoxy)-4-methoxybenzeneethanethioamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.