CAS 1193389-43-3

2,4-Dichloro-1-phenyl-1H-imidazole-5-methanamine

Description:

2,4-Dichloro-1-phenyl-1H-imidazole-5-methanamine is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of two chlorine atoms at the 2 and 4 positions of the imidazole ring contributes to its reactivity and potential biological activity. The phenyl group attached to the imidazole provides additional aromatic character and may influence the compound's solubility and interaction with biological targets. The methanamine group at the 5 position introduces an amine functionality, which can participate in hydrogen bonding and may enhance the compound's pharmacological properties. This compound is of interest in medicinal chemistry and may exhibit various biological activities, making it a candidate for further research in drug development. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₉Cl₂N₃

InChI: InChI=1S/C10H9Cl2N3/c11-9-8(6-13)15(10(12)14-9)7-4-2-1-3-5-7/h1-5H,6,13H2

InChI key: InChIKey=OHGYOSHRDQVDNW-UHFFFAOYSA-N

SMILES: C(N)C=1N(C(Cl)=NC1Cl)C2=CC=CC=C2

Synonyms:

• 2,4-Dichloro-1-phenyl-1H-imidazole-5-methanamine
• 1H-Imidazole-5-methanamine, 2,4-dichloro-1-phenyl-