CAS 1193389-46-6

6-Quinazolinamine, 5,6,7,8-tetrahydro-2-phenyl-, hydrochloride (1:2)

Description:

6-Quinazolinamine, 5,6,7,8-tetrahydro-2-phenyl-, hydrochloride (1:2) is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This substance typically exhibits properties associated with amines, such as basicity due to the presence of nitrogen atoms. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for storage and handling. The tetrahydro configuration suggests that the compound has undergone partial hydrogenation, resulting in a saturated structure that may influence its biological activity and reactivity. The phenyl group attached to the quinazolinamine structure can contribute to its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the biological significance of quinazoline derivatives in various therapeutic areas.

Formula: C₁₄H₁₅N₃·2ClH

InChI: InChI=1S/C14H15N3.2ClH/c15-12-6-7-13-11(8-12)9-16-14(17-13)10-4-2-1-3-5-10;;/h1-5,9,12H,6-8,15H2;2*1H

InChI key: InChIKey=KCJCPHPJYATBJT-UHFFFAOYSA-N

SMILES: NC1CC=2C(=NC(=NC2)C3=CC=CC=C3)CC1.Cl

Synonyms:

• 6-Quinazolinamine, 5,6,7,8-tetrahydro-2-phenyl-, hydrochloride (1:2)