
CAS 1193389-50-2
:3-Piperidinecarboxamide, N-(4,5-dihydro-1-methyl-4-oxo-1H-imidazol-2-yl)-, hydrochloride (1:1)
Description:
3-Piperidinecarboxamide, N-(4,5-dihydro-1-methyl-4-oxo-1H-imidazol-2-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and imidazole moieties, which contribute to its biological activity. The presence of the piperidine ring suggests potential interactions with biological targets, while the imidazole component may enhance its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential drug candidate, with implications in medicinal chemistry due to its structural features. Its molecular structure indicates the presence of functional groups that could participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. The specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which the compound is handled. Overall, this compound's unique structure positions it as a subject of interest in drug development and research.
Formula:C10H16N4O2·ClH
InChI:InChI=1S/C10H16N4O2.ClH/c1-14-6-8(15)12-10(14)13-9(16)7-3-2-4-11-5-7;/h7,11H,2-6H2,1H3,(H,12,13,15,16);1H
InChI key:InChIKey=VPJGDRJBNBNTPO-UHFFFAOYSA-N
SMILES:N(C(=O)C1CCCNC1)C2=NC(=O)CN2C.Cl
Synonyms:- 3-Piperidinecarboxamide, N-(4,5-dihydro-1-methyl-4-oxo-1H-imidazol-2-yl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.