CAS 1193389-55-7

Benzenemethanamine, 3,4-dimethyl-α-phenyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3,4-dimethyl-α-phenyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine functional group and aromatic structure. This substance features a benzene ring substituted with a phenyl group and two methyl groups at the 3 and 4 positions, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The presence of the amine group suggests potential basicity and reactivity, making it suitable for various chemical reactions, including alkylation and acylation. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and are essential for practical applications. Safety data should also be consulted, as with any chemical substance, to ensure proper handling and usage.

Formula: C₁₅H₁₇N·ClH

InChI: InChI=1S/C15H17N.ClH/c1-11-8-9-14(10-12(11)2)15(16)13-6-4-3-5-7-13;/h3-10,15H,16H2,1-2H3;1H

InChI key: InChIKey=RUZORKOZIOUEJN-UHFFFAOYSA-N

SMILES: C(N)(C1=CC(C)=C(C)C=C1)C2=CC=CC=C2.Cl

Synonyms:

• Benzenemethanamine, 3,4-dimethyl-α-phenyl-, hydrochloride (1:1)