CAS 1193389-56-8

Benzenemethanamine, 3-[(2-ethoxyphenoxy)methyl]-4-fluoro-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3-[(2-ethoxyphenoxy)methyl]-4-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring, an amine group, and a fluorine substituent. This compound features a 2-ethoxyphenoxy group, indicating the presence of an ethoxy group attached to a phenyl ether, contributing to its solubility and reactivity. The hydrochloride form suggests that the compound is a salt, enhancing its stability and solubility in aqueous solutions. Typically, such compounds may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients (APIs). The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. As with many amines, it may participate in hydrogen bonding, affecting its interactions in biological systems. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Further characterization would typically involve spectroscopic methods to elucidate its structure and confirm purity.

Formula: C₁₆H₁₈FNO₂·ClH

InChI: InChI=1S/C16H18FNO2.ClH/c1-2-19-15-5-3-4-6-16(15)20-11-13-9-12(10-18)7-8-14(13)17;/h3-9H,2,10-11,18H2,1H3;1H

InChI key: InChIKey=BKVCZESCOJOLFY-UHFFFAOYSA-N

SMILES: O(CC1=CC(CN)=CC=C1F)C2=C(OCC)C=CC=C2.Cl

Synonyms:

• Benzenemethanamine, 3-[(2-ethoxyphenoxy)methyl]-4-fluoro-, hydrochloride (1:1)

[3-(2-Ethoxyphenoxymethyl)-4-fluorophenyl]methanamine hydrochloride

CAS: 1193389-56-8

Versatile small molecule scaffold

Formula: C₁₆H₁₉ClFNO₂

Purity: Min. 95%

Molecular weight: 311.78 g/mol

Ref: 3D-TXB38956