CymitQuimica logo

CAS 1193389-60-4

:

1H-Pyrazole-3-propanamine, 5-(3-fluorophenyl)-N,1-dimethyl-, hydrochloride (1:2)

Description:
1H-Pyrazole-3-propanamine, 5-(3-fluorophenyl)-N,1-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a propanamine side chain and a 3-fluorophenyl group, contributing to its unique properties and potential biological activity. The presence of the hydrochloride salt form indicates that it is a hydrochloride salt, which often enhances solubility in water and stability. The dimethyl substitution on the nitrogen atom suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. The compound's CAS number, 1193389-60-4, allows for precise identification in chemical databases, facilitating research and development. Overall, this compound may have applications in pharmaceuticals, particularly in the development of new therapeutic agents, although specific biological activities would require further investigation.
Formula:C14H18FN3·2ClH
InChI:InChI=1S/C14H18FN3.2ClH/c1-16-8-4-7-13-10-14(18(2)17-13)11-5-3-6-12(15)9-11;;/h3,5-6,9-10,16H,4,7-8H2,1-2H3;2*1H
InChI key:InChIKey=GTCBKNUXACWOPS-UHFFFAOYSA-N
SMILES:CN1C(=CC(CCCNC)=N1)C2=CC(F)=CC=C2.Cl
Synonyms:
  • 1H-Pyrazole-3-propanamine, 5-(3-fluorophenyl)-N,1-dimethyl-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.