CAS 1193389-70-6

4-Piperidinamine, N-(4-fluorophenyl)-, hydrochloride (1:2)

Description:

4-Piperidinamine, N-(4-fluorophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having pharmacological significance, possibly acting as a ligand or inhibitor in biological systems. Its molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in research or industry.

Formula: C₁₁H₁₅FN₂·2ClH

InChI: InChI=1S/C11H15FN2.2ClH/c12-9-1-3-10(4-2-9)14-11-5-7-13-8-6-11;;/h1-4,11,13-14H,5-8H2;2*1H

InChI key: InChIKey=USZJNIIDUJGFGW-UHFFFAOYSA-N

SMILES: N(C1=CC=C(F)C=C1)C2CCNCC2.Cl

Synonyms:

• 4-Piperidinamine, N-(4-fluorophenyl)-, hydrochloride (1:2)

(4-Fluoro-phenyl)-piperidin-4-yl-amine dihydrochloride

CAS: 1193389-70-6

Formula: C₁₁H₁₇Cl₂FN₂

Molecular weight: 267.17

Ref: 10-F031965

N-(4-Fluorophenyl)piperidin-4-amine dihydrochloride

Controlled Product

CAS: 1193389-70-6

Versatile small molecule scaffold

Formula: C₁₁H₁₇Cl₂FN₂

Purity: Min. 95%

Molecular weight: 267.17 g/mol

Ref: 3D-TXB38970