CAS 1193389-72-8

Cyclohexanecarboxylic acid, 1-amino-4-(1,1-dimethylethyl)-, hydrochloride (1:1)

Description:

Cyclohexanecarboxylic acid, 1-amino-4-(1,1-dimethylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclohexane ring structure with a carboxylic acid functional group and an amino group substituted at specific positions. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its steric bulk, which can influence its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as moderate acidity due to the carboxylic acid group and basicity from the amino group, allowing it to participate in acid-base reactions. Its molecular structure suggests potential for hydrogen bonding, which can affect its physical properties like melting and boiling points. Additionally, the compound may have implications in medicinal chemistry, particularly in the design of biologically active molecules. However, specific biological activity and toxicity profiles would require further investigation.

Formula: C₁₁H₂₁NO₂·ClH

InChI: InChI=1S/C11H21NO2.ClH/c1-10(2,3)8-4-6-11(12,7-5-8)9(13)14;/h8H,4-7,12H2,1-3H3,(H,13,14);1H

InChI key: InChIKey=GJSIHGMVBVDEET-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)CCC(C(C)(C)C)CC1.Cl

Synonyms:

• Cyclohexanecarboxylic acid, 1-amino-4-(1,1-dimethylethyl)-, hydrochloride (1:1)

1-Amino-4-tert-butylcyclohexane-1-carboxylic acid hydrochloride

CAS: 1193389-72-8

Versatile small molecule scaffold

Formula: C₁₁H₂₂ClNO₂

Purity: Min. 95%

Molecular weight: 235.75 g/mol

Ref: 3D-TXB38972