CAS 1193389-77-3

Benzenamine, 3-fluoro-4-(1H-pyrazol-1-yl)-, hydrochloride (1:1)

Description:

Benzenamine, 3-fluoro-4-(1H-pyrazol-1-yl)-, hydrochloride (1:1), with CAS number 1193389-77-3, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a fluorine atom and a pyrazole moiety. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The compound exhibits properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interaction with biological systems. Its specific functional groups suggest potential uses in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of biologically active compounds. Additionally, the fluorine substitution may impart unique electronic properties, affecting the compound's pharmacokinetics and pharmacodynamics. As with many chemical substances, safety data and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₈FN₃·ClH

InChI: InChI=1S/C9H8FN3.ClH/c10-8-6-7(11)2-3-9(8)13-5-1-4-12-13;/h1-6H,11H2;1H

InChI key: InChIKey=XSVXPUHDHNWJOW-UHFFFAOYSA-N

SMILES: FC1=C(N2C=CC=N2)C=CC(N)=C1.Cl

Synonyms:

• Benzenamine, 3-fluoro-4-(1H-pyrazol-1-yl)-, hydrochloride (1:1)

3-Fluoro-4-(1H-pyrazol-1-yl)aniline hydrochloride

CAS: 1193389-77-3

3-Fluoro-4-(1H-pyrazol-1-yl)aniline hydrochloride

Purity: ≥95%

Molecular weight: 213.64g/mol

Ref: 54-PC410077