
CAS 1193389-79-5
:1-(4-Methoxyphenyl)-1H-pyrazole-3-methanamine
Description:
1-(4-Methoxyphenyl)-1H-pyrazole-3-methanamine, identified by its CAS number 1193389-79-5, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-methoxyphenyl group indicates that there is a methoxy substituent on a phenyl ring, contributing to the compound's aromatic properties and potentially influencing its reactivity and solubility. The methanamine functional group suggests the presence of an amine, which can participate in hydrogen bonding and may affect the compound's biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways. However, detailed studies on its physical properties, such as melting point, boiling point, solubility, and specific biological activities, would be necessary to fully understand its characteristics and potential uses.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c1-15-11-4-2-10(3-5-11)14-7-6-9(8-12)13-14/h2-7H,8,12H2,1H3
InChI key:InChIKey=YALYWHRMDNVVIO-UHFFFAOYSA-N
SMILES:C(N)C1=NN(C=C1)C2=CC=C(OC)C=C2
Synonyms:- 1H-Pyrazole-3-methanamine, 1-(4-methoxyphenyl)-
- 1-(4-Methoxyphenyl)-1H-pyrazole-3-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.