CAS 1193389-89-7

Benzeneethanol, β-amino-2,5-difluoro-, hydrochloride (1:1)

Description:

Benzeneethanol, β-amino-2,5-difluoro-, hydrochloride (1:1), with CAS number 1193389-89-7, is a chemical compound characterized by its structure, which includes a benzene ring substituted with an ethanol group and a β-amino group that features two fluorine atoms at the 2 and 5 positions. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of fluorine atoms often imparts unique properties, such as increased lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The hydrochloride form indicates that the compound can exist as a stable crystalline solid, which is advantageous for storage and handling. In terms of safety, like many fluorinated compounds, it may exhibit specific toxicological profiles, necessitating careful handling and assessment in laboratory settings. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research and development.

Formula: C₈H₉F₂NO·ClH

InChI: InChI=1S/C8H9F2NO.ClH/c9-5-1-2-7(10)6(3-5)8(11)4-12;/h1-3,8,12H,4,11H2;1H

InChI key: InChIKey=ZSITZKWTMIGQEY-UHFFFAOYSA-N

SMILES: C(CO)(N)C1=C(F)C=CC(F)=C1.Cl

Synonyms:

• Benzeneethanol, β-amino-2,5-difluoro-, hydrochloride (1:1)