CAS 1193389-91-1: N-(3-Amino-4-fluorophenyl)-3-hydroxy-1-propanesulfonamide

Description: N-(3-Amino-4-fluorophenyl)-3-hydroxy-1-propanesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the amino and hydroxy groups contributes to its potential biological activity, making it of interest in medicinal chemistry. The fluorine atom in the para position of the aromatic ring can enhance the compound's lipophilicity and metabolic stability, potentially influencing its pharmacokinetic properties. This compound is likely to exhibit polar characteristics due to the sulfonamide and hydroxy groups, which may affect its solubility in various solvents. Additionally, the structural features suggest that it could engage in hydrogen bonding, which is crucial for its interactions with biological targets. Overall, N-(3-Amino-4-fluorophenyl)-3-hydroxy-1-propanesulfonamide represents a class of compounds that may have therapeutic applications, particularly in the development of new drugs targeting bacterial infections or other diseases.

Formula: C₉H₁₃FN₂O₃S

InChI: InChI=1S/C9H13FN2O3S/c10-8-3-2-7(6-9(8)11)12-16(14,15)5-1-4-13/h2-3,6,12-13H,1,4-5,11H2

InChI key: InChIKey=ABQSLFFTQUWEDM-UHFFFAOYSA-N

SMILES: O=S(=O)(NC1=CC=C(F)C(N)=C1)CCCO

Synonyms:

• N-(3-Amino-4-fluorophenyl)-3-hydroxy-1-propanesulfonamide
• 1-Propanesulfonamide, N-(3-amino-4-fluorophenyl)-3-hydroxy-

N-(3-Amino-4-fluorophenyl)-3-hydroxypropane-1-sulfonamide

CAS: 1193389-91-1

Versatile small molecule scaffold

• Formula: C₉H₁₃FN₂O₃S
• Purity: Min. 95%
• Molecular weight: 248.28 g/mol

n-(3-Amino-4-fluorophenyl)-3-hydroxypropane-1-sulfonamide

CAS: 1193389-91-1

• Purity: 95%
• Molecular weight: 248.27000427246094