CAS 1193389-98-8

1H-Imidazole, 2-(4-nitrophenyl)-, hydrochloride (1:1)

Description:

1H-Imidazole, 2-(4-nitrophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of the 4-nitrophenyl group indicates that a nitro group is substituted on the phenyl ring, contributing to the compound's potential reactivity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and biochemical research. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and the nitro group can influence its electronic properties. Safety and handling precautions should be observed, as nitro compounds can be sensitive and may pose health risks. Overall, this compound's unique structural features and properties make it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₉H₇N₃O₂·ClH

InChI: InChI=1S/C9H7N3O2.ClH/c13-12(14)8-3-1-7(2-4-8)9-10-5-6-11-9;/h1-6H,(H,10,11);1H

InChI key: InChIKey=BWANNMWFNRUYPK-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC=C(C=C1)C=2NC=CN2.Cl

Synonyms:

• 1H-Imidazole, 2-(4-nitrophenyl)-, hydrochloride (1:1)