CAS 1193389-99-9

2-Methylpyrazolo[1,5-a]pyrimidine-6-carbothioamide

Description:

2-Methylpyrazolo[1,5-a]pyrimidine-6-carbothioamide is a heterocyclic compound characterized by its unique pyrazolo and pyrimidine ring structures, which contribute to its potential biological activity. This compound features a methyl group at the 2-position of the pyrazolo ring and a carbothioamide functional group at the 6-position of the pyrimidine ring, which can influence its reactivity and solubility. The presence of sulfur in the carbothioamide group may enhance its interactions with biological targets, making it of interest in medicinal chemistry. The compound is typically synthesized through specific organic reactions that involve the formation of the pyrazolo and pyrimidine rings, followed by the introduction of the carbothioamide group. Its properties, such as melting point, solubility, and spectral characteristics, are essential for understanding its behavior in various chemical environments and potential applications in pharmaceuticals or agrochemicals. As with many heterocycles, the electronic and steric effects of the substituents play a crucial role in determining its chemical reactivity and biological activity.

Formula: C₈H₈N₄S

InChI: InChI=1S/C8H8N4S/c1-5-2-7-10-3-6(8(9)13)4-12(7)11-5/h2-4H,1H3,(H2,9,13)

InChI key: InChIKey=FTVJXALHBNWTDO-UHFFFAOYSA-N

SMILES: C(N)(=S)C1=CN2C(N=C1)=CC(C)=N2

Synonyms:

• 2-Methylpyrazolo[1,5-a]pyrimidine-6-carbothioamide
• Pyrazolo[1,5-a]pyrimidine-6-carbothioamide, 2-methyl-

2-Methylpyrazolo[1,5-a]pyrimidine-6-carbothioamide

CAS: 1193389-99-9

Versatile small molecule scaffold

Formula: C₈H₈N₄S

Purity: Min. 95%

Molecular weight: 192.24 g/mol

Ref: 3D-TXB38999