CAS 1193390-01-0

Benzenemethanesulfonamide, 2-(aminomethyl)-N-methyl-, hydrochloride (1:1)

Description:

Benzenemethanesulfonamide, 2-(aminomethyl)-N-methyl-, hydrochloride (1:1), commonly referred to as a sulfonamide compound, is characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a benzene ring attached to a methanesulfonamide moiety, with an aminomethyl group and a methyl group on the nitrogen atom, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The presence of the amino group suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. Its structure allows for hydrogen bonding, which can influence its reactivity and interaction with biological targets. The compound may exhibit various pharmacological activities, including antimicrobial effects, and is often studied for its potential therapeutic applications. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₉H₁₄N₂O₂S·ClH

InChI: InChI=1S/C9H14N2O2S.ClH/c1-11-14(12,13)7-9-5-3-2-4-8(9)6-10;/h2-5,11H,6-7,10H2,1H3;1H

InChI key: InChIKey=KGLXQWDEXZEGKJ-UHFFFAOYSA-N

SMILES: C(S(NC)(=O)=O)C1=C(CN)C=CC=C1.Cl

Synonyms:

• Benzenemethanesulfonamide, 2-(aminomethyl)-N-methyl-, hydrochloride (1:1)