CAS 1193390-28-1

1H-Pyrazole-1-acetamide, N-(4-amino-2-methylphenyl)-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-acetamide, N-(4-amino-2-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole and acetamide functional groups, which contribute to its potential biological activity. This substance is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments. The presence of the 4-amino-2-methylphenyl moiety suggests that it may exhibit properties related to amine functionality, such as hydrogen bonding and potential reactivity with electrophiles. The compound's structure indicates it may be of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its molecular interactions could be influenced by the presence of the pyrazole ring, which is known for its role in various biological systems. Additionally, the hydrochloride form often aids in stability and handling in laboratory settings. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information, as the specific biological effects and safety profile would depend on further empirical studies.

Formula: C₁₂H₁₄N₄O·ClH

InChI: InChI=1S/C12H14N4O.ClH/c1-9-7-10(13)3-4-11(9)15-12(17)8-16-6-2-5-14-16;/h2-7H,8,13H2,1H3,(H,15,17);1H

InChI key: InChIKey=YAKAICAQPMTMEJ-UHFFFAOYSA-N

SMILES: N(C(CN1C=CC=N1)=O)C2=C(C)C=C(N)C=C2.Cl

Synonyms:

• 1H-Pyrazole-1-acetamide, N-(4-amino-2-methylphenyl)-, hydrochloride (1:1)