CymitQuimica logo

CAS 1193390-35-0

:

N-[(2,2,2-Trifluoroethoxy)carbonyl]-β-alanine

Description:
N-[(2,2,2-Trifluoroethoxy)carbonyl]-β-alanine is a chemical compound characterized by its unique functional groups and structural features. It contains a β-alanine backbone, which is an amino acid known for its role in protein synthesis and as a neurotransmitter. The presence of the trifluoroethoxy carbonyl group introduces significant polarity and influences the compound's solubility and reactivity. This trifluoromethyl group is known for its electron-withdrawing properties, which can enhance the compound's stability and alter its interaction with biological systems. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the presence of nucleophiles or electrophiles in its environment. Additionally, the trifluoroethoxy moiety may impart unique pharmacological properties, making it of interest in medicinal chemistry. Overall, N-[(2,2,2-Trifluoroethoxy)carbonyl]-β-alanine is a compound with potential applications in various fields, including pharmaceuticals and agrochemicals, due to its distinctive chemical characteristics.
Formula:C6H8F3NO4
InChI:InChI=1S/C6H8F3NO4/c7-6(8,9)3-14-5(13)10-2-1-4(11)12/h1-3H2,(H,10,13)(H,11,12)
InChI key:InChIKey=DXOIWHMKTOCHCM-UHFFFAOYSA-N
SMILES:C(OCC(F)(F)F)(NCCC(O)=O)=O
Synonyms:
  • β-Alanine, N-[(2,2,2-trifluoroethoxy)carbonyl]-
  • N-[(2,2,2-Trifluoroethoxy)carbonyl]-β-alanine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.