CymitQuimica logo

CAS 1193390-39-4

:

1,5,6,7-Tetrahydrocyclopenta[b]pyrazolo[4,3-e]pyridin-3-amine

Description:
1,5,6,7-Tetrahydrocyclopenta[b]pyrazolo[4,3-e]pyridin-3-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound features a tetrahydrocyclopenta framework, indicating the presence of a saturated five-membered ring fused to a pyrazole ring. The amine functional group at the 3-position contributes to its potential reactivity and solubility in various solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in the structure can influence its electronic properties and interactions with biological targets. Additionally, the compound's stereochemistry and substituents can significantly affect its pharmacokinetic and pharmacodynamic profiles. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be leveraged in synthetic applications. Overall, this compound represents a unique scaffold that may have implications in pharmaceutical research.
Formula:C9H10N4
InChI:InChI=1S/C9H10N4/c10-8-6-4-5-2-1-3-7(5)11-9(6)13-12-8/h4H,1-3H2,(H3,10,11,12,13)
InChI key:InChIKey=QSXSKXFIOXGFLE-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC3=C(C2)CCC3)=NN1
Synonyms:
  • Cyclopenta[b]pyrazolo[4,3-e]pyridin-3-amine, 1,5,6,7-tetrahydro-
  • 1,5,6,7-Tetrahydrocyclopenta[b]pyrazolo[4,3-e]pyridin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.