CAS 1193390-45-2

Cycloheptanamine, 1-(4-methyl-2-thiazolyl)-, hydrochloride (1:1)

Description:

Cycloheptanamine, 1-(4-methyl-2-thiazolyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclic amine structure, which includes a seven-membered cycloheptane ring. The presence of a thiazole ring, specifically a 4-methyl-2-thiazolyl group, contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit various pharmacological effects, potentially acting as a neurotransmitter modulator or having other biological activities, although specific mechanisms would require further investigation. Its molecular structure suggests it may participate in hydrogen bonding due to the amine and thiazole functionalities, influencing its reactivity and interaction with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a class of organic molecules with potential applications in medicinal chemistry and related fields.

Formula: C₁₁H₁₈N₂S·ClH

InChI: InChI=1S/C11H18N2S.ClH/c1-9-8-14-10(13-9)11(12)6-4-2-3-5-7-11;/h8H,2-7,12H2,1H3;1H

InChI key: InChIKey=HSMAUTBGFUBWIR-UHFFFAOYSA-N

SMILES: NC1(CCCCCC1)C=2SC=C(C)N2.Cl

Synonyms:

• Cycloheptanamine, 1-(4-methyl-2-thiazolyl)-, hydrochloride (1:1)

1-(4-Methyl-1,3-thiazol-2-yl)cycloheptan-1-amine hydrochloride

CAS: 1193390-45-2

Versatile small molecule scaffold

Formula: C₁₁H₁₉ClN₂S

Purity: Min. 95%

Molecular weight: 246.8 g/mol

Ref: 3D-TXB39045