CAS 1193390-47-4

β-Alanine, N-(5-chloro-2-methoxyphenyl)-, hydrochloride (1:1)

Description:

β-Alanine, N-(5-chloro-2-methoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a β-alanine moiety linked to a 5-chloro-2-methoxyphenyl group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions. β-Alanine itself is a non-essential amino acid that plays a role in the synthesis of carnosine, a dipeptide important for muscle function and pH regulation. The presence of the chloro and methoxy substituents on the phenyl ring can influence the compound's biological activity and pharmacological properties. As a hydrochloride, it is likely to exhibit stability and ease of handling, making it suitable for various applications in research and potentially in pharmaceuticals. The compound's characteristics, including its melting point, solubility, and reactivity, would be influenced by its specific molecular structure and the presence of functional groups. Safety data and handling precautions should be consulted due to the presence of chlorine, which can impart toxicity.

Formula: C₁₀H₁₂ClNO₃·ClH

InChI: InChI=1S/C10H12ClNO3.ClH/c1-15-9-3-2-7(11)6-8(9)12-5-4-10(13)14;/h2-3,6,12H,4-5H2,1H3,(H,13,14);1H

InChI key: InChIKey=PKBGSQVPUGCOAH-UHFFFAOYSA-N

SMILES: N(CCC(O)=O)C1=C(OC)C=CC(Cl)=C1.Cl

Synonyms:

• β-Alanine, N-(5-chloro-2-methoxyphenyl)-, hydrochloride (1:1)

3-[(5-Chloro-2-methoxyphenyl)amino]propanoic acid hydrochloride

CAS: 1193390-47-4

Versatile small molecule scaffold

Formula: C₁₀H₁₃Cl₂NO₃

Purity: Min. 95%

Molecular weight: 266.12 g/mol

Ref: 3D-TXB39047