CAS 1193390-48-5

4,9-Dihydro-2-methyl-9-oxopyrazolo[5,1-b]quinazoline-3-carboxaldehyde

Description:

4,9-Dihydro-2-methyl-9-oxopyrazolo[5,1-b]quinazoline-3-carboxaldehyde is a heterocyclic compound characterized by its complex structure, which includes a pyrazoloquinazoline framework. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the 9-oxo group indicates that it may exhibit unique chemical properties, such as the ability to participate in various chemical reactions, including nucleophilic additions and condensation reactions. The methyl group at the 2-position can influence the compound's solubility and biological activity. Additionally, the fused ring system may impart specific pharmacological properties, making it of interest in drug discovery and development. Overall, this compound's structural features suggest potential utility in various chemical and biological applications, although specific biological activities and properties would require further investigation through experimental studies.

Formula: C₁₂H₉N₃O₂

InChI: InChI=1S/C12H9N3O2/c1-7-9(6-16)11-13-10-5-3-2-4-8(10)12(17)15(11)14-7/h2-6,13H,1H3

InChI key: InChIKey=DKPITBLRBUXYGG-UHFFFAOYSA-N

SMILES: C(=O)C1=C2N(C(=O)C=3C(N2)=CC=CC3)N=C1C

Synonyms:

• Pyrazolo[5,1-b]quinazoline-3-carboxaldehyde, 4,9-dihydro-2-methyl-9-oxo-
• 2-Methyl-9-oxo-4H,9H-pyrazolo[3,2-b]quinazoline-3-carbaldehyde
• 4,9-Dihydro-2-methyl-9-oxopyrazolo[5,1-b]quinazoline-3-carboxaldehyde

2-Methyl-9-oxo-4H,9H-pyrazolo[3,2-b]quinazoline-3-carbaldehyde

CAS: 1193390-48-5

Versatile small molecule scaffold

Formula: C₁₂H₉N₃O₂

Purity: Min. 95%

Molecular weight: 227.22 g/mol

Ref: 3D-TXB39048