CAS 1193390-49-6

2-Piperidinone, 1-[3-(aminomethyl)phenyl]-, hydrochloride (1:1)

Description:

2-Piperidinone, 1-[3-(aminomethyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone core, which is a cyclic amide featuring a six-membered ring containing nitrogen. This compound includes an aminomethyl group attached to a phenyl ring, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a hydrochloride, which enhances its solubility in water and may influence its pharmacokinetic properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of both the piperidinone and the aminomethyl phenyl moiety suggests that it may interact with neurotransmitter systems or other biological targets. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by factors such as pH, temperature, and the presence of other chemical species. Safety and handling precautions should be observed due to the potential for biological activity and toxicity.

Formula: C₁₂H₁₆N₂O·ClH

InChI: InChI=1S/C12H16N2O.ClH/c13-9-10-4-3-5-11(8-10)14-7-2-1-6-12(14)15;/h3-5,8H,1-2,6-7,9,13H2;1H

InChI key: InChIKey=CVFWHPQEMOHLDN-UHFFFAOYSA-N

SMILES: O=C1N(C2=CC(CN)=CC=C2)CCCC1.Cl

Synonyms:

• 2-Piperidinone, 1-[3-(aminomethyl)phenyl]-, hydrochloride (1:1)

1-[3-(Aminomethyl)phenyl]piperidin-2-one hydrochloride

CAS: 1193390-49-6

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 240.73 g/mol

Ref: 3D-TXB39049