CAS 1193390-52-1

Benzonitrile, 4-(4-amino-2-chlorophenoxy)-, hydrochloride (1:1)

Description:

Benzonitrile, 4-(4-amino-2-chlorophenoxy)-, hydrochloride (1:1), with CAS number 1193390-52-1, is a chemical compound characterized by its structural features that include a benzonitrile moiety and an amino group substituted on a chlorophenoxy ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The presence of the amino and chloro substituents suggests potential biological activity, making it of interest in pharmaceutical research. Its hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in biological systems. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any potential hazards associated with exposure.

Formula: C₁₃H₉ClN₂O·ClH

InChI: InChI=1S/C13H9ClN2O.ClH/c14-12-7-10(16)3-6-13(12)17-11-4-1-9(8-15)2-5-11;/h1-7H,16H2;1H

InChI key: InChIKey=GKWFYXUPWLLNRZ-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=C(N)C=C1)C2=CC=C(C#N)C=C2.Cl

Synonyms:

• Benzonitrile, 4-(4-amino-2-chlorophenoxy)-, hydrochloride (1:1)