CAS 1193390-57-6

Benzoic acid, 4-[(4-pyridinylamino)methyl]-, hydrochloride (1:1)

Description:

Benzoic acid, 4-[(4-pyridinylamino)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzoic acid moiety and a pyridinylamino group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The presence of the pyridine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, depending on its specific interactions within biological systems. Its molecular structure allows for hydrogen bonding, which can influence its solubility and reactivity. As with many hydrochloride salts, it is likely to be stable under standard laboratory conditions but should be handled with care due to potential irritant properties. Proper storage in a cool, dry place away from light is recommended to maintain its integrity.

Formula: C₁₃H₁₂N₂O₂·ClH

InChI: InChI=1S/C13H12N2O2.ClH/c16-13(17)11-3-1-10(2-4-11)9-15-12-5-7-14-8-6-12;/h1-8H,9H2,(H,14,15)(H,16,17);1H

InChI key: InChIKey=QGTBNLCEFANGAJ-UHFFFAOYSA-N

SMILES: C(NC=1C=CN=CC1)C2=CC=C(C(O)=O)C=C2.Cl

Synonyms:

• Benzoic acid, 4-[(4-pyridinylamino)methyl]-, hydrochloride (1:1)

4-{[(Pyridin-4-yl)amino]methyl}benzoic acid hydrochloride

CAS: 1193390-57-6

Versatile small molecule scaffold

Formula: C₁₃H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 264.71 g/mol

Ref: 3D-TXB39057