CymitQuimica logo

CAS 1193390-58-7

:

4-Methyl 5-methyl-3-propyl-1H-pyrrole-2,4-dicarboxylate

Description:
4-Methyl 5-methyl-3-propyl-1H-pyrrole-2,4-dicarboxylate is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two carboxylate groups, which are known for their ability to participate in various chemical reactions, including esterification and decarboxylation. The presence of multiple methyl and propyl substituents contributes to its hydrophobic nature and can influence its solubility in organic solvents. The compound's molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the specific arrangement of substituents can affect the compound's reactivity and interaction with biological systems. As with many pyrrole derivatives, it may exhibit interesting electronic properties due to the conjugated system within the ring. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C11H15NO4
InChI:InChI=1S/C11H15NO4/c1-4-5-7-8(11(15)16-3)6(2)12-9(7)10(13)14/h12H,4-5H2,1-3H3,(H,13,14)
InChI key:InChIKey=XFNHFVZKCXKKFV-UHFFFAOYSA-N
SMILES:C(CC)C=1C(C(OC)=O)=C(C)NC1C(O)=O
Synonyms:
  • 1H-Pyrrole-2,4-dicarboxylic acid, 5-methyl-3-propyl-, 4-methyl ester
  • 4-Methyl 5-methyl-3-propyl-1H-pyrrole-2,4-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.