CAS 1193390-59-8

2-Propanamine, 1-(2-methoxyphenoxy)-, hydrochloride (1:1)

Description:

2-Propanamine, 1-(2-methoxyphenoxy)-, hydrochloride (1:1), with the CAS number 1193390-59-8, is a chemical compound characterized by its amine functional group and ether linkage. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water compared to its free base form. The presence of the methoxyphenoxy group suggests that it may exhibit specific biological activities, potentially influencing its pharmacological properties. This compound may be utilized in various applications, including medicinal chemistry and drug development, due to its structural features that could interact with biological targets. Its stability, reactivity, and potential toxicity would depend on the specific conditions of use and the presence of other chemical entities. As with any chemical substance, proper handling and safety protocols should be observed, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.

Formula: C₁₀H₁₅NO₂·ClH

InChI: InChI=1S/C10H15NO2.ClH/c1-8(11)7-13-10-6-4-3-5-9(10)12-2;/h3-6,8H,7,11H2,1-2H3;1H

InChI key: InChIKey=KEUZNEIKULLANT-UHFFFAOYSA-N

SMILES: O(CC(C)N)C1=C(OC)C=CC=C1.Cl

Synonyms:

• 2-Propanamine, 1-(2-methoxyphenoxy)-, hydrochloride (1:1)
• 1-(2-Aminopropoxy)-2-methoxybenzene hydrochloride
• 1-(2-Methoxyphenoxy)propan-2-amine hydrochloride