CAS 1193390-60-1

Imidazo[1,2-a]pyridine, 2-(dichloromethyl)-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine, 2-(dichloromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused imidazole and pyridine ring system. This compound typically appears as a hydrochloride salt, indicating that it is in a protonated form, which enhances its solubility in polar solvents like water. The presence of the dichloromethyl group suggests that it may exhibit reactivity typical of alkyl halides, potentially participating in nucleophilic substitution reactions. The compound's molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. As with many chemical compounds, safety data sheets should be consulted for handling and toxicity information, as the presence of chlorine atoms may indicate potential hazards. Overall, this compound represents a unique class of heterocyclic compounds with diverse applications in research and industry.

Formula: C₈H₆Cl₂N₂·ClH

InChI: InChI=1S/C8H6Cl2N2.ClH/c9-8(10)6-5-12-4-2-1-3-7(12)11-6;/h1-5,8H;1H

InChI key: InChIKey=QMCXXXOZPLWPGC-UHFFFAOYSA-N

SMILES: C(Cl)(Cl)C=1N=C2N(C1)C=CC=C2.Cl

Synonyms:

• Imidazo[1,2-a]pyridine, 2-(dichloromethyl)-, hydrochloride (1:1)

2-(Dichloromethyl)imidazo[1,2-a]pyridine hydrochloride

CAS: 1193390-60-1

Versatile small molecule scaffold

Formula: C₈H₇Cl₃N₂

Purity: Min. 95%

Molecular weight: 237.5 g/mol

Ref: 3D-TXB39060