CAS 1193390-66-7

1,1-Dimethylethyl N-[1-(4-fluorophenyl)-2-(hydroxyamino)-2-iminoethyl]carbamate

Description:

1,1-Dimethylethyl N-[1-(4-fluorophenyl)-2-(hydroxyamino)-2-iminoethyl]carbamate, identified by its CAS number 1193390-66-7, is a chemical compound that features a complex structure with multiple functional groups. It contains a carbamate moiety, which is characterized by the presence of a carbonyl group (C=O) linked to an amine (NH) and an alkoxy or aryloxy group. The compound also includes a fluorophenyl group, indicating the presence of a fluorine atom attached to a phenyl ring, which can influence its chemical reactivity and biological activity. The hydroxyamino group suggests potential for hydrogen bonding and reactivity, particularly in biological systems. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other chemical species. Overall, the unique combination of functional groups in this compound suggests potential applications in drug development or as a biochemical tool.

Formula: C₁₃H₁₈FN₃O₃

InChI: InChI=1S/C13H18FN3O3/c1-13(2,3)20-12(18)16-10(11(15)17-19)8-4-6-9(14)7-5-8/h4-7,10,19H,1-3H3,(H2,15,17)(H,16,18)

InChI key: InChIKey=OBGKFZGAXUKVGX-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(C(NO)=N)C1=CC=C(F)C=C1

Synonyms:

• 1,1-Dimethylethyl N-[1-(4-fluorophenyl)-2-(hydroxyamino)-2-iminoethyl]carbamate
• Carbamic acid, N-[1-(4-fluorophenyl)-2-(hydroxyamino)-2-iminoethyl]-, 1,1-dimethylethyl ester