CAS 1193390-69-0
:2-[(1-Methyl-1H-pyrazol-4-yl)methylene]hydrazinecarbothioamide
Description:
2-[(1-Methyl-1H-pyrazol-4-yl)methylene]hydrazinecarbothioamide is a chemical compound characterized by its unique structural features, which include a hydrazinecarbothioamide moiety and a substituted pyrazole ring. This compound typically exhibits properties associated with both hydrazine derivatives and thioamide functionalities, which can influence its reactivity and potential applications in various fields, including medicinal chemistry and agrochemicals. The presence of the pyrazole ring may impart specific biological activities, making it of interest for research into new pharmaceuticals. Additionally, the compound's ability to form hydrogen bonds and engage in coordination chemistry can enhance its interactions with biological targets. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 2-[(1-Methyl-1H-pyrazol-4-yl)methylene]hydrazinecarbothioamide represents a versatile structure that may serve as a scaffold for further chemical modifications and investigations into its potential therapeutic effects.
Formula:C6H9N5S
InChI:InChI=1S/C6H9N5S/c1-11-4-5(3-9-11)2-8-10-6(7)12/h2-4H,1H3,(H3,7,10,12)
InChI key:InChIKey=PNVMXCWPCKOFKI-UHFFFAOYSA-N
SMILES:C(=NNC(N)=S)C=1C=NN(C)C1
Synonyms:- Hydrazinecarbothioamide, 2-[(1-methyl-1H-pyrazol-4-yl)methylene]-
- 2-[(1-Methyl-1H-pyrazol-4-yl)methylene]hydrazinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.