CAS 119347-18-1
:Butanoic acid, 2-(acetyloxy)-3-hydroxy-2-methyl-, 1-(acetyloxy)decahydro-1,4a-dimethyl-7-(1-methylethylidene)-6-oxo-2-naphthalenyl ester
Description:
The chemical substance known as Butanoic acid, 2-(acetyloxy)-3-hydroxy-2-methyl-, 1-(acetyloxy)decahydro-1,4a-dimethyl-7-(1-methylethylidene)-6-oxo-2-naphthalenyl ester, with CAS number 119347-18-1, is a complex organic compound characterized by its ester functional groups and multiple hydroxy and acetyloxy substituents. This compound features a butanoic acid backbone, indicating it has a four-carbon carboxylic acid structure, which is modified by the presence of acetyloxy and hydroxy groups that enhance its reactivity and solubility in various solvents. The presence of a naphthalene moiety suggests potential aromatic properties, contributing to its stability and potential applications in organic synthesis or as a pharmaceutical intermediate. The compound's structure indicates it may exhibit biological activity, possibly serving as a precursor or active ingredient in medicinal chemistry. Its intricate arrangement of functional groups may also influence its physical properties, such as melting point, boiling point, and solubility, making it of interest in both research and industrial applications.
Formula:C24H36O8
InChI:InChI=1S/C24H36O8/c1-13(2)17-11-19-22(6,12-18(17)28)10-9-20(24(19,8)32-16(5)27)30-21(29)23(7,14(3)25)31-15(4)26/h14,19-20,25H,9-12H2,1-8H3
InChI key:InChIKey=LLBMDQKIMOBDCW-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1(C)C2C(C)(CCC1OC(C(OC(C)=O)(C(C)O)C)=O)CC(=O)C(=C(C)C)C2
Synonyms:- Argutin
- Butanoic acid, 2-(acetyloxy)-3-hydroxy-2-methyl-, 1-(acetyloxy)decahydro-1,4a-dimethyl-7-(1-methylethylidene)-6-oxo-2-naphthalenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
