CAS 119368-04-6

4-(Phenylmethoxy)-1H-pyrazolo[3,4-b]pyridine

Description:

4-(Phenylmethoxy)-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its unique pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a phenylmethoxy group, which enhances its solubility and may influence its biological activity. Typically, compounds of this class exhibit interesting pharmacological properties, including potential anti-inflammatory, analgesic, or neuroprotective effects, making them of interest in medicinal chemistry. The presence of the pyrazole and pyridine rings contributes to its electronic properties, potentially allowing for interactions with various biological targets. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and π-π stacking interactions, which are crucial for its reactivity and binding affinity in biological systems. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-(Phenylmethoxy)-1H-pyrazolo[3,4-b]pyridine represents a versatile scaffold for further chemical modifications and investigations in drug development.

Formula: C₁₃H₁₁N₃O

InChI: InChI=1S/C13H11N3O/c1-2-4-10(5-3-1)9-17-12-6-7-14-13-11(12)8-15-16-13/h1-8H,9H2,(H,14,15,16)

InChI key: InChIKey=IFYWOBOIEVQQLG-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C3C(NN=C3)=NC=C2

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine, 4-(phenylmethoxy)-
• 4-(Phenylmethoxy)-1H-pyrazolo[3,4-b]pyridine