
CAS 1193698-54-2
:1-Butanaminium, N,N,N-tributyl-, (T-4)-trifluoro(4-methylphenyl)borate(1-) (1:1)
Description:
1-Butanaminium, N,N,N-tributyl-, (T-4)-trifluoro(4-methylphenyl)borate(1-) is an ionic compound characterized by its quaternary ammonium structure, which includes a butyl group and three tributyl groups attached to a nitrogen atom. The presence of the trifluoroborate anion contributes to its unique properties, including potential applications in organic synthesis and catalysis. This compound is likely to exhibit good solubility in organic solvents due to its hydrophobic alkyl chains, while the trifluoroborate moiety may enhance its reactivity and stability in various chemical environments. The presence of the 4-methylphenyl group suggests potential interactions with aromatic systems, which could influence its behavior in chemical reactions. Additionally, the compound's ionic nature may impart specific characteristics such as conductivity in solution. Overall, this substance is of interest in both academic and industrial chemistry for its potential applications in various fields, including materials science and pharmaceuticals.
Formula:C16H36N·C7H7BF3
InChI:InChI=1S/C16H36N.C7H7BF3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-6-2-4-7(5-3-6)8(9,10)11/h5-16H2,1-4H3;2-5H,1H3/q+1;-1
InChI key:InChIKey=UYJYMXVVLCORPH-UHFFFAOYSA-N
SMILES:[B+3]([F-])([F-])([F-])[C-]=1C=CC(C)=CC1.[N+](CCCC)(CCCC)(CCCC)CCCC
Synonyms:- 1-Butanaminium, N,N,N-tributyl-, (T-4)-trifluoro(4-methylphenyl)borate(1-) (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.