CymitQuimica logo

CAS 1193721-40-2

:

N-Ethyl-4-(trifluoromethyl)-2-pyrimidinamine

Description:
N-Ethyl-4-(trifluoromethyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 4-position of the pyrimidine ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The ethyl group at the 1-position contributes to its overall hydrophobic character. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the trifluoromethyl group is known to improve metabolic stability and bioavailability in pharmaceutical compounds. As with many nitrogen-containing heterocycles, N-Ethyl-4-(trifluoromethyl)-2-pyrimidinamine may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Overall, this compound's unique structural features position it as a potentially valuable entity in both research and application contexts.
Formula:C7H8F3N3
InChI:InChI=1S/C7H8F3N3/c1-2-11-6-12-4-3-5(13-6)7(8,9)10/h3-4H,2H2,1H3,(H,11,12,13)
InChI key:InChIKey=CRIJUFYZOMZKPZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC(NCC)=NC=C1
Synonyms:
  • 2-Pyrimidinamine, N-ethyl-4-(trifluoromethyl)-
  • N-Ethyl-4-(trifluoromethyl)-2-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.