CAS 119386-74-2

1-[2-(2,4-Dichlorophenyl)-2-(3-thienylmethoxy)ethyl]-1H-imidazole

Description:

1-[2-(2,4-Dichlorophenyl)-2-(3-thienylmethoxy)ethyl]-1H-imidazole, with CAS number 119386-74-2, is a chemical compound that belongs to the class of imidazole derivatives. This substance typically exhibits a complex structure characterized by the presence of an imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The compound features a dichlorophenyl group, which contributes to its hydrophobic characteristics and potential biological activity. Additionally, the presence of a thienylmethoxy group enhances its structural diversity and may influence its interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including antimicrobial, antifungal, or anticancer activities. The specific characteristics, such as solubility, melting point, and reactivity, can vary based on the molecular interactions and the environment in which the compound is studied. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and drug development.

Formula: C₁₆H₁₄Cl₂N₂OS

InChI: InChI=1S/C16H14Cl2N2OS/c17-13-1-2-14(15(18)7-13)16(8-20-5-4-19-11-20)21-9-12-3-6-22-10-12/h1-7,10-11,16H,8-9H2

InChI key: InChIKey=WSCZZAJFIDKWCY-UHFFFAOYSA-N

SMILES: C(CN1C=CN=C1)(OCC=2C=CSC2)C3=C(Cl)C=C(Cl)C=C3

Synonyms:

• 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(3-thienylmethoxy)ethyl]-
• 1-[2-(2,4-Dichlorophenyl)-2-(3-thienylmethoxy)ethyl]-1H-imidazole

Tioconazole EP Impurity A

CAS: 119386-74-2

Formula: C₁₆H₁₄Cl₂N₂OS

Molecular weight: 353.26

Ref: ST-EA-CP-T92001