CAS 119392-31-3
:1,3-Dioxolane-4-pentanoic acid, 2,2-dimethyl-, ethyl ester, (S)-
Description:
1,3-Dioxolane-4-pentanoic acid, 2,2-dimethyl-, ethyl ester, (S)-, with the CAS number 119392-31-3, is a chemical compound characterized by its unique structure that includes a dioxolane ring and a pentanoic acid moiety. This compound is an ester, which typically indicates that it is formed from the reaction of an alcohol and a carboxylic acid. The presence of the 2,2-dimethyl group suggests that it has branched alkyl chains, which can influence its physical properties such as boiling point and solubility. The (S)- designation indicates that the compound has a specific stereochemistry, which can affect its reactivity and interaction with biological systems. Generally, compounds like this may exhibit properties such as moderate polarity, potential solubility in organic solvents, and specific reactivity patterns due to the functional groups present. Its applications could range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on its biological activity and stability.
Formula:C12H22O4
InChI:InChI=1S/C12H22O4/c1-4-14-11(13)8-6-5-7-10-9-15-12(2,3)16-10/h10H,4-9H2,1-3H3/t10-/m0/s1
InChI key:InChIKey=KWHASROAESAUCA-JTQLQIEISA-N
SMILES:C(CCCC(OCC)=O)[C@@H]1OC(C)(C)OC1
Synonyms:- (S)-Ethyl5-(2,2-dimethyl-1,3-dioxolan-4-yl)pentanoate
- 1,3-Dioxolane-4-pentanoic acid, 2,2-dimethyl-, ethyl ester, (S)-
- (S)-Ethyl 5-(2,2-dimethyl-1,3-dioxolan-4-yl)pentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
