CAS 1194-06-5
:CYCLOPENTYL-UREA
Description:
Cyclopentyl-urea, with the CAS number 1194-06-5, is an organic compound characterized by the presence of a cyclopentyl group attached to a urea moiety. It typically appears as a white crystalline solid and is soluble in polar organic solvents. The compound features a urea functional group, which consists of a carbonyl group (C=O) flanked by two amine groups (NH2), contributing to its potential as a hydrogen bond donor and acceptor. Cyclopentyl-urea is of interest in various fields, including medicinal chemistry, due to its ability to interact with biological targets. Its structural characteristics may influence its pharmacokinetic properties, such as solubility and permeability. Additionally, the cyclopentyl group can impart unique steric and electronic properties, making it a valuable scaffold in drug design. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, cyclopentyl-urea serves as a versatile compound in chemical research and development.
Formula:C6H12N2O
InChI:InChI=1/C6H12N2O/c7-6(9)8-5-3-1-2-4-5/h5H,1-4H2,(H3,7,8,9)
SMILES:C1CCC(C1)NC(=N)O
Synonyms:- 1-Cyclopentylurea
- Cyclopentyl-urea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclopentylurea
CAS:<p>Cyclopentylurea is an inhibitor of the NS3 protease, which is an enzyme that plays a key role in the replication of the hepatitis C virus. Cyclopentylurea binds to the active site of this enzyme and blocks its activity. This inhibition prevents the production of new viral particles and can help treat chronic hepatitis C. Cyclopentylurea has also been shown to have anti-cancer effects, as it inhibits protein synthesis in tumour cells and induces their apoptosis.</p>Formula:C6H12N2OPurity:Min. 95%Molecular weight:128.17 g/mol
