CAS 1194-58-7
:1H-Indole, octahydro-1-methyl-, cis-
Description:
1H-Indole, octahydro-1-methyl-, cis- (CAS 1194-58-7) is a bicyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The "octahydro" designation indicates that the compound has undergone hydrogenation, resulting in a saturated structure with additional hydrogen atoms. The "cis" configuration refers to the spatial arrangement of substituents around the ring system, which can influence the compound's chemical properties and reactivity. This compound is typically colorless to pale yellow and may have a characteristic odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. 1H-Indole derivatives are often studied for their biological activities, including potential applications in pharmaceuticals and agrochemicals. The presence of the methyl group can affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. Overall, this compound represents a unique class of indole derivatives with potential applications in various fields of research.
Formula:C9H17N
InChI:InChI=1/C9H17N/c1-10-7-6-8-4-2-3-5-9(8)10/h8-9H,2-7H2,1H3/t8-,9-/s2
InChI key:InChIKey=AWTMNUUIQAMREG-MDWBIBFBNA-N
SMILES:CN1[C@@]2([C@@](CCCC2)(CC1)[H])[H]
Synonyms:- 1H-Indole, octahydro-1-methyl-, cis-
- Indoline, hexahydro-1-methyl-, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
