CAS 1194-63-4
:pyrazolo[1,5-a]pyrimidin-7-amine
Description:
Pyrazolo[1,5-a]pyrimidin-7-amine is a heterocyclic organic compound characterized by a fused ring system that includes both pyrazole and pyrimidine moieties. This compound typically exhibits a planar structure due to the conjugated system of double bonds, which can contribute to its stability and reactivity. It is often utilized in medicinal chemistry for its potential biological activities, including anti-inflammatory and anticancer properties. The presence of an amino group at the 7-position enhances its solubility and reactivity, making it a valuable scaffold for drug development. Pyrazolo[1,5-a]pyrimidin-7-amine may also participate in various chemical reactions, such as nucleophilic substitutions and cyclizations, due to the electron-rich nature of the pyrazole ring. Its unique structure allows for interactions with biological targets, which is of significant interest in pharmacology. Overall, this compound serves as an important building block in the synthesis of more complex molecules in the field of medicinal chemistry.
Formula:C6H6N4
InChI:InChI=1/C6H6N4/c7-5-1-3-8-6-2-4-9-10(5)6/h1-4H,7H2
SMILES:c1cnc2ccnn2c1N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pyrazolo[1,5-a]pyrimidin-7-amine
CAS:<p>Pyrazolo[1,5-a]pyrimidin-7-amine</p>Formula:C6H6N4Purity:≥95%Color and Shape: light beige powderMolecular weight:134.14g/molPyrazolo[1,5-a]pyrimidin-7-amine
CAS:<p>Pyrazolo[1,5-a]pyrimidin-7-amine is a synthetic compound that was derived from the natural product pyrazolopyrimidine. It has been shown to be an effective inhibitor of growth in human liver cancer cells and in virus replication. Pyrazolo[1,5-a]pyrimidin-7-amine also inhibits the growth of human liver cancer cells by binding to the factor receptor, which is involved in platelet-derived growth. This drug inhibits the production of platelet-derived growth factor (PDGF) by binding to the PDGF receptor on cells. Pyrazolo[1,5-a]pyrimidin-7-amine does not inhibit cell proliferation but rather induces cell death by apoptosis in Mcf-7 human breast cancer cells.</p>Formula:C6H6N4Purity:Min. 95%Molecular weight:134.13 g/mol


