CAS 119403-03-1
:N-(5-methyl-1,2-oxazol-3-yl)-4-[(Z)-{4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl}-NNO-azoxy]benzenesulfonamide
Description:
N-(5-methyl-1,2-oxazol-3-yl)-4-[(Z)-{4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl}-NNO-azoxy]benzenesulfonamide, identified by CAS number 119403-03-1, is a complex organic compound characterized by its unique structural features, including multiple functional groups such as sulfonamide, azoxy, and oxazole moieties. This compound exhibits potential biological activity, often investigated for its pharmacological properties. The presence of the oxazole ring suggests possible interactions with biological targets, while the sulfonamide group may contribute to its solubility and reactivity. The compound's Z-configuration indicates specific stereochemistry, which can influence its biological activity and interactions. Additionally, the presence of aromatic rings enhances its stability and may facilitate interactions with various biological systems. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry, particularly in the development of therapeutic agents. Further studies would be necessary to elucidate its specific properties, mechanisms of action, and potential applications in drug development.
Formula:C20H18N6O7S2
InChI:InChI=1/C20H18N6O7S2/c1-13-11-19(22-32-13)24-34(28,29)17-7-3-15(4-8-17)21-26(27)16-5-9-18(10-6-16)35(30,31)25-20-12-14(2)33-23-20/h3-12H,1-2H3,(H,22,24)(H,23,25)/b26-21-
SMILES:Cc1cc(no1)NS(=O)(=O)c1ccc(cc1)/N=N(\O)/c1ccc(cc1)S(=O)(=O)Nc1cc(C)on1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.