CAS 119425-89-7
:Loureirin A
Description:
Loureirin A is a natural compound classified as a flavonoid, specifically a type of flavonol, derived from the plant species *Loureiroa*. It is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. The molecular structure of Loureirin A features multiple hydroxyl groups, which contribute to its reactivity and biological activity. This compound has garnered interest in medicinal chemistry due to its ability to modulate various biological pathways, making it a candidate for further research in therapeutic applications. Additionally, Loureirin A exhibits a complex stereochemistry, which is crucial for its interaction with biological targets. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its bioavailability and efficacy. Overall, Loureirin A represents a significant area of study within natural products chemistry, with ongoing investigations into its mechanisms of action and potential uses in drug development.
Formula:C17H18O4
InChI:InChI=1S/C17H18O4/c1-20-15-9-5-13(17(11-15)21-2)6-10-16(19)12-3-7-14(18)8-4-12/h3-5,7-9,11,18H,6,10H2,1-2H3
InChI key:InChIKey=RSAIVLRELNGZEY-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(O)C=C1)C2=C(OC)C=C(OC)C=C2
Synonyms:- 1-Propanone, 3-(2,4-Dimethoxyphenyl)-1-(4-Hydroxyphenyl)-
- 3-(2,4-Dimethoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone
- 4′-Hydroxy-2,4-dimethoxydihydrochalcone
- Loureirin A
- 3-(2,4-Dimethoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Loureirin A
CAS:Loureirin A has an inhibitory effect on platelet activation, perhaps through an impairment of PI3K/Akt signaling. Loureirin A activates Wnt/-catenin pathway and promotes hair follicle stem cells (FSCs)-seeded tissue-engineered skin to repair skin wound.The molecular mechanism of Loureirin A and Wnt signaling pathway mediated anti- hepatic fibrosis and anti- angiogenesis may involve down- regulation the expression of Frizzled- 4,inhibiting the synthesis and secretion of α- SMA,TGF- β1and the proliferation of HSCs.Formula:C17H18O4Purity:95%~99%Color and Shape:PowderMolecular weight:286.327Loureirin A
CAS:Loureirin A inhibits platelet aggregation and PI3K/Akt signaling, promotes hair follicle repair, and has anti-fibrotic and anti-angiogenic properties.Formula:C17H18O4Purity:99.83% - 99.97%Color and Shape:SolidMolecular weight:286.32Ref: TM-T5S0896
2mgTo inquire5mg49.00€10mg74.00€25mg135.00€50mg197.00€100mg295.00€1mL*10mM (DMSO)52.00€






