CAS 119432-89-2

(2S)-1,2,3,4-Tetrahydro-8-methoxy-N,N-dipropyl-2-naphthalenamine

Description:

(2S)-1,2,3,4-Tetrahydro-8-methoxy-N,N-dipropyl-2-naphthalenamine, with CAS number 119432-89-2, is a chemical compound characterized by its complex structure, which includes a naphthalene core and a tetrahydro configuration. This substance features a methoxy group and two propyl groups attached to a nitrogen atom, contributing to its unique properties. It is classified as a tertiary amine due to the presence of the nitrogen atom bonded to three carbon-containing groups. The stereochemistry indicated by the (2S) designation suggests that it has specific spatial arrangements that can influence its biological activity and interactions. This compound may exhibit pharmacological properties, potentially acting as a ligand for various receptors, although specific biological activities would depend on further empirical studies. Its solubility, stability, and reactivity can be influenced by the presence of the methoxy and propyl substituents, making it of interest in medicinal chemistry and drug development.

Formula: C₁₇H₂₇NO

InChI: InChI=1S/C17H27NO/c1-4-11-18(12-5-2)15-10-9-14-7-6-8-17(19-3)16(14)13-15/h6-8,15H,4-5,9-13H2,1-3H3/t15-/m0/s1

InChI key: InChIKey=SPOMVKJPPZWHRF-HNNXBMFYSA-N

SMILES: O(C)C1=C2C(CC[C@H](N(CCC)CCC)C2)=CC=C1

Synonyms:

• (2S)-1,2,3,4-Tetrahydro-8-methoxy-N,N-dipropyl-2-naphthalenamine
• 2-Naphthalenamine, 1,2,3,4-tetrahydro-8-methoxy-N,N-dipropyl-, (S)-
• 2-Naphthalenamine 1,2,3,4-tetrahydro-8-methoxy-N,N-dipropyl-, (2S)-
• 2-Naphthalenamine, 1,2,3,4-tetrahydro-8-methoxy-N,N-dipropyl-, (2S)-

2-Naphthalenamine, 1,2,3,4-tetrahydro-8-methoxy-N,N-dipropyl-, (2S)-

CAS: 119432-89-2

Formula: C₁₇H₂₇NO

Molecular weight: 261.4024

Ref: IN-DA000IQJ