CymitQuimica logo

CAS 1194374-10-1

:

1H-Pyrazolo[4,3-c]pyridine, 4,5,6,7-tetrahydro-7,7-dimethyl-, hydrochloride (1:1)

Description:
1H-Pyrazolo[4,3-c]pyridine, 4,5,6,7-tetrahydro-7,7-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The tetrahydro configuration indicates that the compound has undergone partial hydrogenation, contributing to its stability and potential biological activity. It is often studied for its pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The presence of the dimethyl groups enhances its lipophilicity, which may influence its interaction with biological targets. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties, making it a subject of interest in both synthetic and medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H13N3·ClH
InChI:InChI=1S/C8H13N3.ClH/c1-8(2)5-9-3-6-4-10-11-7(6)8;/h4,9H,3,5H2,1-2H3,(H,10,11);1H
InChI key:InChIKey=GZEBVCQRCXEFKX-UHFFFAOYSA-N
SMILES:CC1(C)C2=C(CNC1)C=NN2.Cl
Synonyms:
  • 1H-Pyrazolo[4,3-c]pyridine, 4,5,6,7-tetrahydro-7,7-dimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.