CAS 1194374-28-1
:Methyl 3-(6-chloro-2-pyrazinyl)benzoate
Description:
Methyl 3-(6-chloro-2-pyrazinyl)benzoate is an organic compound characterized by its structure, which includes a benzoate moiety and a pyrazine ring substituted with a chlorine atom. This compound typically appears as a crystalline solid and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the chloro group introduces electrophilic properties, which can influence its reactivity in various chemical reactions, such as nucleophilic substitutions. The pyrazine ring contributes to the compound's potential biological activity, as heterocyclic compounds often exhibit diverse pharmacological properties. Methyl 3-(6-chloro-2-pyrazinyl)benzoate may be of interest in medicinal chemistry and agrochemical applications due to its structural features. Additionally, its synthesis may involve standard organic reactions such as esterification and halogenation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound exemplifies the complexity and utility of substituted aromatic compounds in chemical research and application.
Formula:C12H9ClN2O2
InChI:InChI=1S/C12H9ClN2O2/c1-17-12(16)9-4-2-3-8(5-9)10-6-14-7-11(13)15-10/h2-7H,1H3
InChI key:InChIKey=NVQIDPAIHMONPK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(C=CC1)C2=NC(Cl)=CN=C2
Synonyms:- Methyl 3-(6-chloro-2-pyrazinyl)benzoate
- Benzoic acid, 3-(6-chloro-2-pyrazinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
