CAS 1194374-30-5
:2′-(Methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid
Description:
2′-(Methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methylsulfonyl group (-SO2CH3) at the 2' position and a carboxylic acid group (-COOH) at the 3 position contributes to its chemical reactivity and solubility properties. This compound is likely to exhibit polar characteristics due to the sulfonyl and carboxylic acid functional groups, which can engage in hydrogen bonding and ionic interactions. It may also show potential as a pharmaceutical intermediate or in various chemical syntheses due to its functional groups. The compound's molecular structure suggests it could participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C14H12O4S
InChI:InChI=1S/C14H12O4S/c1-19(17,18)13-8-3-2-7-12(13)10-5-4-6-11(9-10)14(15)16/h2-9H,1H3,(H,15,16)
InChI key:InChIKey=GHTSRQDYRIBSDN-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C=CC=C1)C2=CC(C(O)=O)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-carboxylic acid, 2′-(methylsulfonyl)-
- 2′-(Methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid
- 2′-Methanesulfonyl-biphenyl-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
