
CAS 1194374-34-9
:2-Chloro-4-(1-methylethyl)-5-thiazolecarboxylic acid
Description:
2-Chloro-4-(1-methylethyl)-5-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a chloro substituent at the 2-position and an isopropyl group at the 4-position of the thiazole ring, along with a carboxylic acid functional group at the 5-position. The presence of the carboxylic acid group contributes to its acidity and potential reactivity in various chemical reactions. The thiazole moiety is known for its biological activity, making this compound of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential applications in the development of herbicides or pharmaceuticals, particularly due to the presence of the chlorine atom, which can enhance biological activity or alter the compound's solubility. As with many thiazole derivatives, it may exhibit antimicrobial or antifungal properties, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C7H8ClNO2S
InChI:InChI=1S/C7H8ClNO2S/c1-3(2)4-5(6(10)11)12-7(8)9-4/h3H,1-2H3,(H,10,11)
InChI key:InChIKey=IFHJWSZHSBSJCH-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(C(O)=O)SC(Cl)=N1
Synonyms:- 5-Thiazolecarboxylic acid, 2-chloro-4-(1-methylethyl)-
- 2-Chloro-4-(1-methylethyl)-5-thiazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.